About 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide
2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (PubChem CID 106685480) has the molecular formula C8H7ClF3NO2
and a molecular weight of 241.60 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| PubChem CID | 106685480 |
| Molecular Formula | C8H7ClF3NO2 |
| Molecular Weight | 241.60 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C8H7ClF3NO2/c1-13(4-8(10,11)12)7(14)5-2-3-15-6(5)9/h2-3H,4H2,1H3 |
| InChIKey | LLUULUMYYWJDEK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide?
The IUPAC name of 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (CID 106685480) is 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
What is the SMILES notation for 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide?
The canonical SMILES for 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide is CN(CC(F)(F)F)C(=O)c1ccoc1Cl.
What is the InChIKey of 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide?
The InChIKey is LLUULUMYYWJDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF3NO2/c1-13(4-8(10,11)12)7(14)5-2-3-15-6(5)9/h2-3H,4H2,1H3.
What are the key properties of 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide?
2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide has a molecular weight of 241.60 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methyl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide is sourced from PubChem (CID 106685480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).