C12H15ClF3NO3 — CID 106686312
2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (PubChem CID 106686312) has the molecular formula C12H15ClF3NO3 and a molecular weight of 313.70 g/mol. Its IUPAC name is 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106686312 |
| Molecular Formula | C12H15ClF3NO3 |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-chloro-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C12H15ClF3NO3/c1-2-19-6-3-5-17(8-12(14,15)16)11(18)9-4-7-20-10(9)13/h4,7H,2-3,5-6,8H2,1H3 |
| InChIKey | ROLGIIWMLXCFRW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|