About 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine
4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine (PubChem CID 10668635) has the molecular formula C25H21NO2S
and a molecular weight of 399.52 g/mol. Its IUPAC name is 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine.
Molecular Properties
| Compound Name | 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine |
| PubChem CID | 10668635 |
| Molecular Formula | C25H21NO2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)Sc3ccccc3-n3cccc32)cc1 |
| InChI | InChI=1S/C25H21NO2S/c1-27-20-13-9-18(10-14-20)25(19-11-15-21(28-2)16-12-19)24-8-5-17-26(24)22-6-3-4-7-23(22)29-25/h3-17H,1-2H3 |
| InChIKey | INSJQKGHKLRZAH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine?
The IUPAC name of 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine (CID 10668635) is 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine.
What is the SMILES notation for 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine?
The canonical SMILES for 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine is COc1ccc(C2(c3ccc(OC)cc3)Sc3ccccc3-n3cccc32)cc1.
What is the InChIKey of 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine?
The InChIKey is INSJQKGHKLRZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO2S/c1-27-20-13-9-18(10-14-20)25(19-11-15-21(28-2)16-12-19)24-8-5-17-26(24)22-6-3-4-7-23(22)29-25/h3-17H,1-2H3.
What are the key properties of 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine?
4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine has a molecular weight of 399.52 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(4-methoxyphenyl)pyrrolo[2,1-c][1,4]benzothiazine is sourced from PubChem (CID 10668635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).