About 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide
2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide (PubChem CID 106687085) has the molecular formula C7H6ClF2NO2
and a molecular weight of 209.58 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide |
| PubChem CID | 106687085 |
| Molecular Formula | C7H6ClF2NO2 |
| Molecular Weight | 209.58 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide |
| SMILES | O=C(NCC(F)F)c1ccoc1Cl |
| InChI | InChI=1S/C7H6ClF2NO2/c8-6-4(1-2-13-6)7(12)11-3-5(9)10/h1-2,5H,3H2,(H,11,12) |
| InChIKey | ULAXRGDOCFSJSP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide?
The IUPAC name of 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide (CID 106687085) is 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide.
What is the SMILES notation for 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide?
The canonical SMILES for 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide is O=C(NCC(F)F)c1ccoc1Cl.
What is the InChIKey of 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide?
The InChIKey is ULAXRGDOCFSJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF2NO2/c8-6-4(1-2-13-6)7(12)11-3-5(9)10/h1-2,5H,3H2,(H,11,12).
What are the key properties of 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide?
2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide has a molecular weight of 209.58 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,2-difluoroethyl)furan-3-carboxamide is sourced from PubChem (CID 106687085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).