C19H31NO8 — CID 10668752
tert-butyl N-[(1S)-1-[(3aR,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxoethyl]carbamate (PubChem CID 10668752) has the molecular formula C19H31NO8 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(3aR,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(3aR,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10668752 |
| Molecular Formula | C19H31NO8 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(3aR,4S,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=O)[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H31NO8/c1-17(2,3)28-16(22)20-10(8-21)12-14-15(27-19(6,7)26-14)13(24-12)11-9-23-18(4,5)25-11/h8,10-15H,9H2,1-7H3,(H,20,22)/t10-,11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | GQYNOGXZQNJVFJ-KYFQHEKYSA-N |
| XLogP | 1.52 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|