C14H11ClN2O3 — CID 106687953
3-(5-chlorofuran-2-yl)-4-(4-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 106687953) has the molecular formula C14H11ClN2O3 and a molecular weight of 290.71 g/mol. Its IUPAC name is 3-(5-chlorofuran-2-yl)-4-(4-methoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(5-chlorofuran-2-yl)-4-(4-methoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 106687953 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-(5-chlorofuran-2-yl)-4-(4-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(-c2c(-c3ccc(Cl)o3)noc2N)cc1 |
| InChI | InChI=1S/C14H11ClN2O3/c1-18-9-4-2-8(3-5-9)12-13(17-20-14(12)16)10-6-7-11(15)19-10/h2-7H,16H2,1H3 |
| InChIKey | NBDLJKDFBXEGEV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |