C15H11Cl2NO3 — CID 106688723
2-chloro-N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]furan-3-carboxamide (PubChem CID 106688723) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 2-chloro-N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106688723 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-chloro-N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cc(C#CCCO)ccc1Cl)c1ccoc1Cl |
| InChI | InChI=1S/C15H11Cl2NO3/c16-12-5-4-10(3-1-2-7-19)9-13(12)18-15(20)11-6-8-21-14(11)17/h4-6,8-9,19H,2,7H2,(H,18,20) |
| InChIKey | MAJMEJFGIWNBMN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|