C24H29N5O — CID 10668890
N-[(6S,8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]-7H-purin-6-amine (PubChem CID 10668890) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(6S,8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]-7H-purin-6-amine.
| Compound Name | N-[(6S,8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 10668890 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[(6S,8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]-7H-purin-6-amine |
| SMILES | COc1ccc2c(c1)[C@@H](Nc1ncnc3nc[nH]c13)C[C@@H]1[C@@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C24H29N5O/c1-24-8-3-4-19(24)17-11-20(29-23-21-22(26-12-25-21)27-13-28-23)18-10-14(30-2)5-6-15(18)16(17)7-9-24/h5-6,10,12-13,16-17,19-20H,3-4,7-9,11H2,1-2H3,(H2,25,26,27,28,29)/t16-,17-,19+,20+,24+/m1/s1 |
| InChIKey | LFNUZFBGDQTABZ-SIRRTAETSA-N |
| XLogP | 5.22 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |