About 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene
1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene (PubChem CID 10668927) has the molecular formula C21H18F2O4S
and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene |
| PubChem CID | 10668927 |
| Molecular Formula | C21H18F2O4S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene |
| SMILES | COc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C21H18F2O4S/c1-26-20-9-6-14(10-21(20)27-2)17-12-19(23)18(22)11-16(17)13-4-7-15(8-5-13)28(3,24)25/h4-12H,1-3H3 |
| InChIKey | LTICETBYOXBZNU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene (CID 10668927) is 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene is COc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The InChIKey is LTICETBYOXBZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2O4S/c1-26-20-9-6-14(10-21(20)27-2)17-12-19(23)18(22)11-16(17)13-4-7-15(8-5-13)28(3,24)25/h4-12H,1-3H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene has a molecular weight of 404.43 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene is sourced from PubChem (CID 10668927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).