C25H40O4 — CID 10668965
(1R,5aS,5bR,7aR,9S,11aR,11bR,13R,13aS,13bS)-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1,9,13-triol (PubChem CID 10668965) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (1R,5aS,5bR,7aR,9S,11aR,11bR,13R,13aS,13bS)-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1,9,13-triol.
| Compound Name | (1R,5aS,5bR,7aR,9S,11aR,11bR,13R,13aS,13bS)-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1,9,13-triol |
|---|---|
| PubChem CID | 10668965 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (1R,5aS,5bR,7aR,9S,11aR,11bR,13R,13aS,13bS)-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1,9,13-triol |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3C[C@@H](O)[C@]4(C)[C@@H]5C(=CC[C@H]4[C@]3(C)CC[C@@H]12)CO[C@H]5O |
| InChI | InChI=1S/C25H40O4/c1-22(2)15-8-10-24(4)16-7-6-14-13-29-21(28)20(14)25(16,5)19(27)12-17(24)23(15,3)11-9-18(22)26/h6,15-21,26-28H,7-13H2,1-5H3/t15-,16-,17+,18-,19+,20+,21+,23-,24-,25+/m0/s1 |
| InChIKey | FJUOWUVQEVUWDX-MAVWPOPNSA-N |
| XLogP | 3.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|