C12H8ClN3O2 — CID 106690695
5-(5-chlorofuran-2-yl)-4-pyridin-3-yl-1,2-oxazol-3-amine (PubChem CID 106690695) has the molecular formula C12H8ClN3O2 and a molecular weight of 261.67 g/mol. Its IUPAC name is 5-(5-chlorofuran-2-yl)-4-pyridin-3-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(5-chlorofuran-2-yl)-4-pyridin-3-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 106690695 |
| Molecular Formula | C12H8ClN3O2 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5-(5-chlorofuran-2-yl)-4-pyridin-3-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(Cl)o2)c1-c1cccnc1 |
| InChI | InChI=1S/C12H8ClN3O2/c13-9-4-3-8(17-9)11-10(12(14)16-18-11)7-2-1-5-15-6-7/h1-6H,(H2,14,16) |
| InChIKey | FWRBUAWJGHEZHR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |