C14H13ClO2 — CID 106690860
1-(2-chlorofuran-3-yl)-2-(3,5-dimethylphenyl)ethanone (PubChem CID 106690860) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-yl)-2-(3,5-dimethylphenyl)ethanone.
| Compound Name | 1-(2-chlorofuran-3-yl)-2-(3,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 106690860 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-(2-chlorofuran-3-yl)-2-(3,5-dimethylphenyl)ethanone |
| SMILES | Cc1cc(C)cc(CC(=O)c2ccoc2Cl)c1 |
| InChI | InChI=1S/C14H13ClO2/c1-9-5-10(2)7-11(6-9)8-13(16)12-3-4-17-14(12)15/h3-7H,8H2,1-2H3 |
| InChIKey | IAVZUBYPTFHZRI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |