C19H22N2S4 — CID 10669097
3-[5-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,3,4-trimethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione (PubChem CID 10669097) has the molecular formula C19H22N2S4 and a molecular weight of 406.67 g/mol. Its IUPAC name is 3-[5-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,3,4-trimethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione.
| Compound Name | 3-[5-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,3,4-trimethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 10669097 |
| Molecular Formula | C19H22N2S4 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[5-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,3,4-trimethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)n(-c2cc(-n3c(C)c(C)sc3=S)c(C)c(C)c2C)c1C |
| InChI | InChI=1S/C19H22N2S4/c1-9-10(2)16(20-12(4)14(6)24-18(20)22)8-17(11(9)3)21-13(5)15(7)25-19(21)23/h8H,1-7H3 |
| InChIKey | XWKGQWODHKKPND-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|