About (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone
(2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone (PubChem CID 106691245) has the molecular formula C11H9ClN2O4
and a molecular weight of 268.66 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone.
Molecular Properties
| Compound Name | (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone |
| PubChem CID | 106691245 |
| Molecular Formula | C11H9ClN2O4 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)c2ccoc2Cl)c(OC)n1 |
| InChI | InChI=1S/C11H9ClN2O4/c1-16-7-5-13-8(11(14-7)17-2)9(15)6-3-4-18-10(6)12/h3-5H,1-2H3 |
| InChIKey | NMHRCOVQKJCLBB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone?
The IUPAC name of (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone (CID 106691245) is (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone.
What is the SMILES notation for (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone?
The canonical SMILES for (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone is COc1cnc(C(=O)c2ccoc2Cl)c(OC)n1.
What is the InChIKey of (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone?
The InChIKey is NMHRCOVQKJCLBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O4/c1-16-7-5-13-8(11(14-7)17-2)9(15)6-3-4-18-10(6)12/h3-5H,1-2H3.
What are the key properties of (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone?
(2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone has a molecular weight of 268.66 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorofuran-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone is sourced from PubChem (CID 106691245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).