C15H19ClN2O2 — CID 106692879
N-[(2-chlorofuran-3-yl)-(5-ethoxy-3-pyridinyl)methyl]propan-1-amine (PubChem CID 106692879) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-[(2-chlorofuran-3-yl)-(5-ethoxy-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(2-chlorofuran-3-yl)-(5-ethoxy-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106692879 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[(2-chlorofuran-3-yl)-(5-ethoxy-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cncc(OCC)c1)c1ccoc1Cl |
| InChI | InChI=1S/C15H19ClN2O2/c1-3-6-18-14(13-5-7-20-15(13)16)11-8-12(19-4-2)10-17-9-11/h5,7-10,14,18H,3-4,6H2,1-2H3 |
| InChIKey | SOLMNFGUHSLRLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |