C12H12O8S4 — CID 10669366
tetramethyl (3Z,7Z)-1,2,5,6-tetrathiocine-3,4,7,8-tetracarboxylate (PubChem CID 10669366) has the molecular formula C12H12O8S4 and a molecular weight of 412.49 g/mol. Its IUPAC name is tetramethyl (3Z,7Z)-1,2,5,6-tetrathiocine-3,4,7,8-tetracarboxylate.
| Compound Name | tetramethyl (3Z,7Z)-1,2,5,6-tetrathiocine-3,4,7,8-tetracarboxylate |
|---|---|
| PubChem CID | 10669366 |
| Molecular Formula | C12H12O8S4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | tetramethyl (3Z,7Z)-1,2,5,6-tetrathiocine-3,4,7,8-tetracarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)SS/C(C(=O)OC)=C(/C(=O)OC)SS1 |
| InChI | InChI=1S/C12H12O8S4/c1-17-9(13)5-6(10(14)18-2)22-24-8(12(16)20-4)7(23-21-5)11(15)19-3/h1-4H3/b6-5-,8-7- |
| InChIKey | UWUWGDAMBLJZEX-ISTTXYCBSA-N |
| XLogP | 1.88 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|