C29H32O2 — CID 10669382
(8R,9S,13S,14S,17R)-13-methyl-17-(naphthalen-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10669382) has the molecular formula C29H32O2 and a molecular weight of 412.57 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methyl-17-(naphthalen-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-13-methyl-17-(naphthalen-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10669382 |
| Molecular Formula | C29H32O2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-17-(naphthalen-2-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H32O2/c1-28-14-12-25-24-11-9-23(30)17-22(24)8-10-26(25)27(28)13-15-29(28,31)18-19-6-7-20-4-2-3-5-21(20)16-19/h2-7,9,11,16-17,25-27,30-31H,8,10,12-15,18H2,1H3/t25-,26-,27+,28+,29-/m1/s1 |
| InChIKey | XJXAUFBQLRCHSB-MJXUZWQSSA-N |
| XLogP | 6.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |