C22H26N2O6 — CID 10669471
13-tert-butyl-15,16-dimethoxy-2,6-dinitrotricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene (PubChem CID 10669471) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 13-tert-butyl-15,16-dimethoxy-2,6-dinitrotricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene.
| Compound Name | 13-tert-butyl-15,16-dimethoxy-2,6-dinitrotricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
|---|---|
| PubChem CID | 10669471 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 13-tert-butyl-15,16-dimethoxy-2,6-dinitrotricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
| SMILES | COc1c2cc([N+](=O)[O-])cc1CC([N+](=O)[O-])c1cc(C(C)(C)C)cc(c1OC)CC2 |
| InChI | InChI=1S/C22H26N2O6/c1-22(2,3)16-8-13-6-7-14-9-17(23(25)26)10-15(20(14)29-4)11-19(24(27)28)18(12-16)21(13)30-5/h8-10,12,19H,6-7,11H2,1-5H3 |
| InChIKey | PYUITVOFRPHEQH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|