C11H6BrClF3NO2 — CID 106695089
3-[3-bromo-5-(trifluoromethyl)phenyl]-4-chloropyrrolidine-2,5-dione (PubChem CID 106695089) has the molecular formula C11H6BrClF3NO2 and a molecular weight of 356.53 g/mol. Its IUPAC name is 3-[3-bromo-5-(trifluoromethyl)phenyl]-4-chloropyrrolidine-2,5-dione.
| Compound Name | 3-[3-bromo-5-(trifluoromethyl)phenyl]-4-chloropyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106695089 |
| Molecular Formula | C11H6BrClF3NO2 |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 3-[3-bromo-5-(trifluoromethyl)phenyl]-4-chloropyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cc(Br)cc(C(F)(F)F)c2)C1Cl |
| InChI | InChI=1S/C11H6BrClF3NO2/c12-6-2-4(1-5(3-6)11(14,15)16)7-8(13)10(19)17-9(7)18/h1-3,7-8H,(H,17,18,19) |
| InChIKey | UPPVDWMKBVTPOM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|