C17H13ClN2O4S — CID 10669517
[(E)-(5-chloro-2-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-ylidene)amino] hydrogen sulfate (PubChem CID 10669517) has the molecular formula C17H13ClN2O4S and a molecular weight of 376.82 g/mol. Its IUPAC name is [(E)-(5-chloro-2-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-ylidene)amino] hydrogen sulfate.
| Compound Name | [(E)-(5-chloro-2-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-ylidene)amino] hydrogen sulfate |
|---|---|
| PubChem CID | 10669517 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [(E)-(5-chloro-2-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-ylidene)amino] hydrogen sulfate |
| SMILES | O=S(=O)(O)O/N=C1\CCn2c(-c3ccccc3)cc3c(Cl)ccc1c32 |
| InChI | InChI=1S/C17H13ClN2O4S/c18-14-7-6-12-15(19-24-25(21,22)23)8-9-20-16(10-13(14)17(12)20)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,21,22,23)/b19-15+ |
| InChIKey | QUBCRPMTOIBMFI-XDJHFCHBSA-N |
| XLogP | 3.89 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|