C11H6BrF3N2O4 — CID 106695226
3-bromo-4-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 106695226) has the molecular formula C11H6BrF3N2O4 and a molecular weight of 367.08 g/mol. Its IUPAC name is 3-bromo-4-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3-bromo-4-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106695226 |
| Molecular Formula | C11H6BrF3N2O4 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-bromo-4-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])C1Br |
| InChI | InChI=1S/C11H6BrF3N2O4/c12-8-7(9(18)16-10(8)19)5-2-1-4(11(13,14)15)3-6(5)17(20)21/h1-3,7-8H,(H,16,18,19) |
| InChIKey | HOVPKTJPLSAMQA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|