C13H11NO4S — CID 106696093
5-acetyl-2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106696093) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-acetyl-2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106696093 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 5-acetyl-2-(2-methoxyphenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccccc1-c1nc(C(=O)O)c(C(C)=O)s1 |
| InChI | InChI=1S/C13H11NO4S/c1-7(15)11-10(13(16)17)14-12(19-11)8-5-3-4-6-9(8)18-2/h3-6H,1-2H3,(H,16,17) |
| InChIKey | IPGGLIKVXRIJBY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |