About 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid
5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106696197) has the molecular formula C10H8N2O3S2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 106696197 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(-c2nc(C)cs2)nc1C(=O)O |
| InChI | InChI=1S/C10H8N2O3S2/c1-4-3-16-8(11-4)9-12-6(10(14)15)7(17-9)5(2)13/h3H,1-2H3,(H,14,15) |
| InChIKey | RDNMRAMRMVMZSO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid (CID 106696197) is 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid is CC(=O)c1sc(-c2nc(C)cs2)nc1C(=O)O.
What is the InChIKey of 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is RDNMRAMRMVMZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S2/c1-4-3-16-8(11-4)9-12-6(10(14)15)7(17-9)5(2)13/h3H,1-2H3,(H,14,15).
What are the key properties of 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid?
5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 268.32 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106696197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).