About CID 10669647
CID 10669647 (PubChem CID 10669647) has the molecular formula C26H27NO4
and a molecular weight of 417.51 g/mol.
Molecular Properties
| Compound Name | CID 10669647 |
| PubChem CID | 10669647 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc2c(c1)C1(OOC13C1CC4CC(C1)CC3C4)c1ccccc1N2C |
| InChI | InChI=1S/C26H27NO4/c1-15(28)29-20-7-8-24-22(14-20)26(21-5-3-4-6-23(21)27(24)2)25(30-31-26)18-10-16-9-17(12-18)13-19(25)11-16/h3-8,14,16-19H,9-13H2,1-2H3 |
| InChIKey | GOWJGHFMSDFZQE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 10669647 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10669647?
The IUPAC name of CID 10669647 (CID 10669647) is not available.
What is the SMILES notation for CID 10669647?
The canonical SMILES for CID 10669647 is CC(=O)Oc1ccc2c(c1)C1(OOC13C1CC4CC(C1)CC3C4)c1ccccc1N2C.
What is the InChIKey of CID 10669647?
The InChIKey is GOWJGHFMSDFZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO4/c1-15(28)29-20-7-8-24-22(14-20)26(21-5-3-4-6-23(21)27(24)2)25(30-31-26)18-10-16-9-17(12-18)13-19(25)11-16/h3-8,14,16-19H,9-13H2,1-2H3.
What are the key properties of CID 10669647?
CID 10669647 has a molecular weight of 417.51 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10669647 is sourced from PubChem (CID 10669647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).