C15H16N2O3S — CID 106696709
5-acetyl-2-(2,4,6-trimethylanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106696709) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-acetyl-2-(2,4,6-trimethylanilino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(2,4,6-trimethylanilino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106696709 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-acetyl-2-(2,4,6-trimethylanilino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(Nc2c(C)cc(C)cc2C)nc1C(=O)O |
| InChI | InChI=1S/C15H16N2O3S/c1-7-5-8(2)11(9(3)6-7)16-15-17-12(14(19)20)13(21-15)10(4)18/h5-6H,1-4H3,(H,16,17)(H,19,20) |
| InChIKey | ORTRMZUFZOIHMB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |