C14H14N2O3S — CID 106696860
methyl 5-acetyl-2-(3-methylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 106696860) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is methyl 5-acetyl-2-(3-methylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-acetyl-2-(3-methylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106696860 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | methyl 5-acetyl-2-(3-methylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(Nc2cccc(C)c2)sc1C(C)=O |
| InChI | InChI=1S/C14H14N2O3S/c1-8-5-4-6-10(7-8)15-14-16-11(13(18)19-3)12(20-14)9(2)17/h4-7H,1-3H3,(H,15,16) |
| InChIKey | BWWBISURFRBZIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |