About 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one
1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one (PubChem CID 10669693) has the molecular formula C24H22N2O5
and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one |
| PubChem CID | 10669693 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one |
| SMILES | COc1cc2cc(CO)c(CO)c(-c3ccnc(-n4ccccc4=O)c3)c2cc1OC |
| InChI | InChI=1S/C24H22N2O5/c1-30-20-10-16-9-17(13-27)19(14-28)24(18(16)12-21(20)31-2)15-6-7-25-22(11-15)26-8-4-3-5-23(26)29/h3-12,27-28H,13-14H2,1-2H3 |
| InChIKey | SJQXOZSDYOZKJF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one?
The IUPAC name of 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one (CID 10669693) is 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one.
What is the SMILES notation for 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one?
The canonical SMILES for 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one is COc1cc2cc(CO)c(CO)c(-c3ccnc(-n4ccccc4=O)c3)c2cc1OC.
What is the InChIKey of 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one?
The InChIKey is SJQXOZSDYOZKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O5/c1-30-20-10-16-9-17(13-27)19(14-28)24(18(16)12-21(20)31-2)15-6-7-25-22(11-15)26-8-4-3-5-23(26)29/h3-12,27-28H,13-14H2,1-2H3.
What are the key properties of 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one?
1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one has a molecular weight of 418.45 g/mol, XLogP of 3.05, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2,3-bis(hydroxymethyl)-6,7-dimethoxynaphthalen-1-yl]-2-pyridinyl]pyridin-2-one is sourced from PubChem (CID 10669693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).