C24H28F3NO2 — CID 10669754
2,2,2-trifluoro-N-[(1R,2S)-2-[(4R)-4-methylhept-1-en-4-yl]oxy-1,2-diphenylethyl]acetamide (PubChem CID 10669754) has the molecular formula C24H28F3NO2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2S)-2-[(4R)-4-methylhept-1-en-4-yl]oxy-1,2-diphenylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2S)-2-[(4R)-4-methylhept-1-en-4-yl]oxy-1,2-diphenylethyl]acetamide |
|---|---|
| PubChem CID | 10669754 |
| Molecular Formula | C24H28F3NO2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2S)-2-[(4R)-4-methylhept-1-en-4-yl]oxy-1,2-diphenylethyl]acetamide |
| SMILES | C=CC[C@@](C)(CCC)O[C@@H](c1ccccc1)[C@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H28F3NO2/c1-4-16-23(3,17-5-2)30-21(19-14-10-7-11-15-19)20(18-12-8-6-9-13-18)28-22(29)24(25,26)27/h4,6-15,20-21H,1,5,16-17H2,2-3H3,(H,28,29)/t20-,21+,23+/m1/s1 |
| InChIKey | JGNCKMCAXFSDQW-GIWBLDEGSA-N |
| XLogP | 6.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|