C12H13N3O5S — CID 106697807
5-acetyl-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 106697807) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-acetyl-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106697807 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-acetyl-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(N2CC(=O)NC(=O)C2(C)C)nc1C(=O)O |
| InChI | InChI=1S/C12H13N3O5S/c1-5(16)8-7(9(18)19)14-11(21-8)15-4-6(17)13-10(20)12(15,2)3/h4H2,1-3H3,(H,18,19)(H,13,17,20) |
| InChIKey | UYHDROXFDROBSC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|