About 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline
4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline (PubChem CID 10669803) has the molecular formula C23H24N4O4
and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline |
| PubChem CID | 10669803 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline |
| SMILES | COc1ccc(-c2nc(Cn3ccnc3C)nc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C23H24N4O4/c1-14-24-8-9-27(14)13-22-25-17-12-21(31-5)20(30-4)11-16(17)23(26-22)15-6-7-18(28-2)19(10-15)29-3/h6-12H,13H2,1-5H3 |
| InChIKey | FBVKEEVPXLTELG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline (CID 10669803) is 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline is COc1ccc(-c2nc(Cn3ccnc3C)nc3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline?
The InChIKey is FBVKEEVPXLTELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O4/c1-14-24-8-9-27(14)13-22-25-17-12-21(31-5)20(30-4)11-16(17)23(26-22)15-6-7-18(28-2)19(10-15)29-3/h6-12H,13H2,1-5H3.
What are the key properties of 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline?
4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline has a molecular weight of 420.47 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[(2-methylimidazol-1-yl)methyl]quinazoline is sourced from PubChem (CID 10669803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).