C20H24N2S4 — CID 10669835
3-[3-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione (PubChem CID 10669835) has the molecular formula C20H24N2S4 and a molecular weight of 420.69 g/mol. Its IUPAC name is 3-[3-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione.
| Compound Name | 3-[3-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 10669835 |
| Molecular Formula | C20H24N2S4 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-[3-(4,5-dimethyl-2-sulfanylidene-1,3-thiazol-3-yl)-2,4,5,6-tetramethylphenyl]-4,5-dimethyl-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)n(-c2c(C)c(C)c(C)c(-n3c(C)c(C)sc3=S)c2C)c1C |
| InChI | InChI=1S/C20H24N2S4/c1-9-10(2)17(21-13(5)15(7)25-19(21)23)12(4)18(11(9)3)22-14(6)16(8)26-20(22)24/h1-8H3 |
| InChIKey | VZBGUHBHGZVCCP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|