C26H48O2Si — CID 10669838
(2Z,5E)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-4-enylidene]-6,10-dimethylundeca-5,9-dien-1-ol (PubChem CID 10669838) has the molecular formula C26H48O2Si and a molecular weight of 420.75 g/mol. Its IUPAC name is (2Z,5E)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-4-enylidene]-6,10-dimethylundeca-5,9-dien-1-ol.
| Compound Name | (2Z,5E)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-4-enylidene]-6,10-dimethylundeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 10669838 |
| Molecular Formula | C26H48O2Si |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (2Z,5E)-2-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-4-enylidene]-6,10-dimethylundeca-5,9-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C26H48O2Si/c1-22(2)13-10-14-23(3)15-11-17-25(21-27)18-12-16-24(4)19-20-28-29(8,9)26(5,6)7/h13,15,18-19,27H,10-12,14,16-17,20-21H2,1-9H3/b23-15+,24-19+,25-18- |
| InChIKey | CMPJNZQCOLZUIJ-UZADUACUSA-N |
| XLogP | 8.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|