About 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate
3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate (PubChem CID 10669967) has the molecular formula C24H26FN3O3
and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate.
Molecular Properties
| Compound Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate |
| PubChem CID | 10669967 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate |
| SMILES | O=C(OCCCN1CCC(c2noc3cc(F)ccc23)CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H26FN3O3/c25-19-6-7-20-22(16-19)31-26-23(20)18-8-12-27(13-9-18)11-3-15-30-24(29)28-14-10-17-4-1-2-5-21(17)28/h1-2,4-7,16,18H,3,8-15H2 |
| InChIKey | GGXJKCUEQAODHJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate?
The IUPAC name of 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate (CID 10669967) is 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate?
The canonical SMILES for 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate is O=C(OCCCN1CCC(c2noc3cc(F)ccc23)CC1)N1CCc2ccccc21.
What is the InChIKey of 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate?
The InChIKey is GGXJKCUEQAODHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26FN3O3/c25-19-6-7-20-22(16-19)31-26-23(20)18-8-12-27(13-9-18)11-3-15-30-24(29)28-14-10-17-4-1-2-5-21(17)28/h1-2,4-7,16,18H,3,8-15H2.
What are the key properties of 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate?
3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate has a molecular weight of 423.49 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 10669967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).