C13H18FNO3 — CID 106699705
methyl 2-fluoro-4-[(1-hydroxybutan-2-ylamino)methyl]benzoate (PubChem CID 106699705) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(1-hydroxybutan-2-ylamino)methyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(1-hydroxybutan-2-ylamino)methyl]benzoate |
|---|---|
| PubChem CID | 106699705 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 2-fluoro-4-[(1-hydroxybutan-2-ylamino)methyl]benzoate |
| SMILES | CCC(CO)NCc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C13H18FNO3/c1-3-10(8-16)15-7-9-4-5-11(12(14)6-9)13(17)18-2/h4-6,10,15-16H,3,7-8H2,1-2H3 |
| InChIKey | MFBMGJFFLCNTQY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |