About [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate
[(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 10669993) has the molecular formula C19H31NO2Sn
and a molecular weight of 424.17 g/mol. Its IUPAC name is [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 10669993 |
| Molecular Formula | C19H31NO2Sn |
| Molecular Weight | 424.17 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@]1([Sn](C)(C)C)CCc2ccccc21)C(C)C |
| InChI | InChI=1S/C16H22NO2.3CH3.Sn/c1-11(2)17(12(3)4)16(18)19-15-10-9-13-7-5-6-8-14(13)15;;;;/h5-8,11-12H,9-10H2,1-4H3;3*1H3; |
| InChIKey | RWRYPDQNLZNFNI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.17 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate (CID 10669993) is [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)O[C@]1([Sn](C)(C)C)CCc2ccccc21)C(C)C.
What is the InChIKey of [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate?
The InChIKey is RWRYPDQNLZNFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22NO2.3CH3.Sn/c1-11(2)17(12(3)4)16(18)19-15-10-9-13-7-5-6-8-14(13)15;;;;/h5-8,11-12H,9-10H2,1-4H3;3*1H3;.
What are the key properties of [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate?
[(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate has a molecular weight of 424.17 g/mol, XLogP of 4.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-trimethylstannyl-2,3-dihydroinden-1-yl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 10669993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).