C14H19FN2O4 — CID 106700421
methyl 2-fluoro-4-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]benzoate (PubChem CID 106700421) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is methyl 2-fluoro-4-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 106700421 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | methyl 2-fluoro-4-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]benzoate |
| SMILES | COCCNC(=O)CNCc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O4/c1-20-6-5-17-13(18)9-16-8-10-3-4-11(12(15)7-10)14(19)21-2/h3-4,7,16H,5-6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | HCLDBACUPDDFKD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|