C21H23N5O5 — CID 10670055
(2R,3R,4R,5R,6E)-6-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 10670055) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is (2R,3R,4R,5R,6E)-6-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R,6E)-6-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10670055 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2R,3R,4R,5R,6E)-6-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)/C=N/Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23N5O5/c27-12-16(29)20(31)19(30)15(28)11-22-25-21-23-17(13-7-3-1-4-8-13)18(24-26-21)14-9-5-2-6-10-14/h1-11,15-16,19-20,27-31H,12H2,(H,23,25,26)/b22-11+/t15-,16-,19-,20-/m1/s1 |
| InChIKey | HUBNXGRZAYFUOR-OIPASYHMSA-N |
| XLogP | 0.04 |
| TPSA | 164.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|