About N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine
N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine (PubChem CID 106701329) has the molecular formula C18H20BrNO
and a molecular weight of 346.27 g/mol. Its IUPAC name is N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine |
| PubChem CID | 106701329 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine |
| SMILES | Cc1cc(C)c(NC2c3ccccc3OC2(C)C)c(Br)c1 |
| InChI | InChI=1S/C18H20BrNO/c1-11-9-12(2)16(14(19)10-11)20-17-13-7-5-6-8-15(13)21-18(17,3)4/h5-10,17,20H,1-4H3 |
| InChIKey | PCWRZXVGOHBSAI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine?
The IUPAC name of N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine (CID 106701329) is N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine.
What is the SMILES notation for N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine?
The canonical SMILES for N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine is Cc1cc(C)c(NC2c3ccccc3OC2(C)C)c(Br)c1.
What is the InChIKey of N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine?
The InChIKey is PCWRZXVGOHBSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrNO/c1-11-9-12(2)16(14(19)10-11)20-17-13-7-5-6-8-15(13)21-18(17,3)4/h5-10,17,20H,1-4H3.
What are the key properties of N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine?
N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine has a molecular weight of 346.27 g/mol, XLogP of 5.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4,6-dimethylphenyl)-2,2-dimethyl-3H-1-benzofuran-3-amine is sourced from PubChem (CID 106701329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).