C13H19NO3 — CID 106701361
N-(2-methoxyethoxy)-2,2-dimethyl-3H-1-benzofuran-3-amine (PubChem CID 106701361) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2,2-dimethyl-3H-1-benzofuran-3-amine.
| Compound Name | N-(2-methoxyethoxy)-2,2-dimethyl-3H-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 106701361 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2-methoxyethoxy)-2,2-dimethyl-3H-1-benzofuran-3-amine |
| SMILES | COCCONC1c2ccccc2OC1(C)C |
| InChI | InChI=1S/C13H19NO3/c1-13(2)12(14-16-9-8-15-3)10-6-4-5-7-11(10)17-13/h4-7,12,14H,8-9H2,1-3H3 |
| InChIKey | GHLLHDCCTXCUKR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|