C25H50O3Si — CID 10670138
(1S)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolan-2-yl]dec-9-en-1-ol (PubChem CID 10670138) has the molecular formula C25H50O3Si and a molecular weight of 426.76 g/mol. Its IUPAC name is (1S)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolan-2-yl]dec-9-en-1-ol.
| Compound Name | (1S)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolan-2-yl]dec-9-en-1-ol |
|---|---|
| PubChem CID | 10670138 |
| Molecular Formula | C25H50O3Si |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (1S)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-pentyloxolan-2-yl]dec-9-en-1-ol |
| SMILES | C=CCCCCCCC[C@H](O)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCC)O1 |
| InChI | InChI=1S/C25H50O3Si/c1-8-10-12-13-14-15-17-18-21(26)23-20-24(22(27-23)19-16-11-9-2)28-29(6,7)25(3,4)5/h8,21-24,26H,1,9-20H2,2-7H3/t21-,22-,23+,24-/m0/s1 |
| InChIKey | XMVYBVOHYRCOLT-XQUALCHDSA-N |
| XLogP | 7.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|