C16H21NO — CID 106701431
N-hex-5-yn-3-yl-2,2-dimethyl-3H-1-benzofuran-3-amine (PubChem CID 106701431) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-hex-5-yn-3-yl-2,2-dimethyl-3H-1-benzofuran-3-amine.
| Compound Name | N-hex-5-yn-3-yl-2,2-dimethyl-3H-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 106701431 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-hex-5-yn-3-yl-2,2-dimethyl-3H-1-benzofuran-3-amine |
| SMILES | C#CCC(CC)NC1c2ccccc2OC1(C)C |
| InChI | InChI=1S/C16H21NO/c1-5-9-12(6-2)17-15-13-10-7-8-11-14(13)18-16(15,3)4/h1,7-8,10-12,15,17H,6,9H2,2-4H3 |
| InChIKey | UCFNXEIMCSYYQZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|