C15H23NOS — CID 106701442
2,2-dimethyl-N-(4-methylsulfanylbutyl)-3H-1-benzofuran-3-amine (PubChem CID 106701442) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylsulfanylbutyl)-3H-1-benzofuran-3-amine.
| Compound Name | 2,2-dimethyl-N-(4-methylsulfanylbutyl)-3H-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 106701442 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylsulfanylbutyl)-3H-1-benzofuran-3-amine |
| SMILES | CSCCCCNC1c2ccccc2OC1(C)C |
| InChI | InChI=1S/C15H23NOS/c1-15(2)14(16-10-6-7-11-18-3)12-8-4-5-9-13(12)17-15/h4-5,8-9,14,16H,6-7,10-11H2,1-3H3 |
| InChIKey | MCIBSEFIENHUOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|