About 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole
3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole (PubChem CID 106701664) has the molecular formula C11H12F3NO
and a molecular weight of 231.22 g/mol. Its IUPAC name is 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole |
| PubChem CID | 106701664 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole |
| SMILES | CC1(C)CNc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C11H12F3NO/c1-10(2)6-15-9-4-3-7(5-8(9)10)16-11(12,13)14/h3-5,15H,6H2,1-2H3 |
| InChIKey | KUJJTAONWGKXDH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole?
The IUPAC name of 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole (CID 106701664) is 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole.
What is the SMILES notation for 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole?
The canonical SMILES for 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole is CC1(C)CNc2ccc(OC(F)(F)F)cc21.
What is the InChIKey of 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole?
The InChIKey is KUJJTAONWGKXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO/c1-10(2)6-15-9-4-3-7(5-8(9)10)16-11(12,13)14/h3-5,15H,6H2,1-2H3.
What are the key properties of 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole?
3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole has a molecular weight of 231.22 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydroindole is sourced from PubChem (CID 106701664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).