About 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane]
5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] (PubChem CID 106701782) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] |
| PubChem CID | 106701782 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] |
| SMILES | CC1CC12CNc1ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C15H21N/c1-10-8-15(10)9-16-13-6-5-11(7-12(13)15)14(2,3)4/h5-7,10,16H,8-9H2,1-4H3 |
| InChIKey | NOJJKWJFUWXENM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane]?
The IUPAC name of 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] (CID 106701782) is 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane].
What is the SMILES notation for 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane]?
The canonical SMILES for 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] is CC1CC12CNc1ccc(C(C)(C)C)cc12.
What is the InChIKey of 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane]?
The InChIKey is NOJJKWJFUWXENM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-10-8-15(10)9-16-13-6-5-11(7-12(13)15)14(2,3)4/h5-7,10,16H,8-9H2,1-4H3.
What are the key properties of 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane]?
5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] has a molecular weight of 215.34 g/mol, XLogP of 3.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2'-methylspiro[1,2-dihydroindole-3,1'-cyclopropane] is sourced from PubChem (CID 106701782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).