C14H11F5N2O4S2 — CID 10670278
2,3,4,5,6-pentafluoro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide (PubChem CID 10670278) has the molecular formula C14H11F5N2O4S2 and a molecular weight of 430.38 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10670278 |
| Molecular Formula | C14H11F5N2O4S2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[2-(4-sulfamoylphenyl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H11F5N2O4S2/c15-9-10(16)12(18)14(13(19)11(9)17)27(24,25)21-6-5-7-1-3-8(4-2-7)26(20,22)23/h1-4,21H,5-6H2,(H2,20,22,23) |
| InChIKey | YDCJJEISAZMIQL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|