C18H17NO2 — CID 106703126
N-(2-acetylphenyl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106703126) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-(2-acetylphenyl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106703126 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(2-acetylphenyl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | CC(=O)c1ccccc1NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H17NO2/c1-12(20)16-8-4-5-9-17(16)19-18(21)15-10-13-6-2-3-7-14(13)11-15/h2-9,15H,10-11H2,1H3,(H,19,21) |
| InChIKey | RBDQHNGXAXUCRT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |