C16H23NO2 — CID 106703980
N-(5-hydroxy-4-methylpentyl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106703980) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(5-hydroxy-4-methylpentyl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-(5-hydroxy-4-methylpentyl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106703980 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(5-hydroxy-4-methylpentyl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | CC(CO)CCCNC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H23NO2/c1-12(11-18)5-4-8-17-16(19)15-9-13-6-2-3-7-14(13)10-15/h2-3,6-7,12,15,18H,4-5,8-11H2,1H3,(H,17,19) |
| InChIKey | OOTDYCGDERIDLT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|