C13H7ClF10N2O — CID 10670401
4-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1,9a-dihydropyrido[1,2-a]pyrimidin-2-one (PubChem CID 10670401) has the molecular formula C13H7ClF10N2O and a molecular weight of 432.65 g/mol. Its IUPAC name is 4-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1,9a-dihydropyrido[1,2-a]pyrimidin-2-one.
| Compound Name | 4-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1,9a-dihydropyrido[1,2-a]pyrimidin-2-one |
|---|---|
| PubChem CID | 10670401 |
| Molecular Formula | C13H7ClF10N2O |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 4-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-1,9a-dihydropyrido[1,2-a]pyrimidin-2-one |
| SMILES | O=C1C=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)N2C=CC=CC2N1 |
| InChI | InChI=1S/C13H7ClF10N2O/c14-13(23,24)12(21,22)11(19,20)10(17,18)9(15,16)6-5-8(27)25-7-3-1-2-4-26(6)7/h1-5,7H,(H,25,27) |
| InChIKey | BZZLOIDUVXZJQT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|