About (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide
(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide (PubChem CID 10670415) has the molecular formula C19H17BrN2OS2
and a molecular weight of 433.40 g/mol. Its IUPAC name is (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide.
Molecular Properties
| Compound Name | (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide |
| PubChem CID | 10670415 |
| Molecular Formula | C19H17BrN2OS2 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide |
| SMILES | CC[n+]1c(/C=C2\SCC(=O)N2c2ccccc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C19H17N2OS2.BrH/c1-2-20-15-10-6-7-11-16(15)24-18(20)12-19-21(17(22)13-23-19)14-8-4-3-5-9-14;/h3-12H,2,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZKQNEOZOLREQRI-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide?
The IUPAC name of (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide (CID 10670415) is (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide.
What is the SMILES notation for (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide?
The canonical SMILES for (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide is CC[n+]1c(/C=C2\SCC(=O)N2c2ccccc2)sc2ccccc21.[Br-].
What is the InChIKey of (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide?
The InChIKey is ZKQNEOZOLREQRI-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H17N2OS2.BrH/c1-2-20-15-10-6-7-11-16(15)24-18(20)12-19-21(17(22)13-23-19)14-8-4-3-5-9-14;/h3-12H,2,13H2,1H3;1H/q+1;/p-1.
What are the key properties of (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide?
(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide has a molecular weight of 433.40 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-phenyl-1,3-thiazolidin-4-one bromide is sourced from PubChem (CID 10670415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).