C13H16F3NO2 — CID 106704511
N-[[4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 106704511) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[[4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106704511 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[[4-(2,2,2-trifluoroethoxymethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)COCOc1ccc(CNC2CC2)cc1 |
| InChI | InChI=1S/C13H16F3NO2/c14-13(15,16)8-18-9-19-12-5-1-10(2-6-12)7-17-11-3-4-11/h1-2,5-6,11,17H,3-4,7-9H2 |
| InChIKey | OXJPEDMOUJEQKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|